About 1,1-difluoroethylsulfonyl sulfite
1,1-difluoroethylsulfonyl sulfite (PubChem CID 167019443) has the molecular formula C2H3F2O5S2-
and a molecular weight of 209.17 g/mol. Its IUPAC name is 1,1-difluoroethylsulfonyl sulfite.
Molecular Properties
| Compound Name | 1,1-difluoroethylsulfonyl sulfite |
| PubChem CID | 167019443 |
| Molecular Formula | C2H3F2O5S2- |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 208.94 |
| IUPAC Name | 1,1-difluoroethylsulfonyl sulfite |
| SMILES | CC(F)(F)S(=O)(=O)OS(=O)[O-] |
| InChI | InChI=1S/C2H4F2O5S2/c1-2(3,4)11(7,8)9-10(5)6/h1H3,(H,5,6)/p-1 |
| InChIKey | KWDDVTYJHSOPPG-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoroethylsulfonyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethylsulfonyl sulfite?
The IUPAC name of 1,1-difluoroethylsulfonyl sulfite (CID 167019443) is 1,1-difluoroethylsulfonyl sulfite.
What is the SMILES notation for 1,1-difluoroethylsulfonyl sulfite?
The canonical SMILES for 1,1-difluoroethylsulfonyl sulfite is CC(F)(F)S(=O)(=O)OS(=O)[O-].
What is the InChIKey of 1,1-difluoroethylsulfonyl sulfite?
The InChIKey is KWDDVTYJHSOPPG-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4F2O5S2/c1-2(3,4)11(7,8)9-10(5)6/h1H3,(H,5,6)/p-1.
What are the key properties of 1,1-difluoroethylsulfonyl sulfite?
1,1-difluoroethylsulfonyl sulfite has a molecular weight of 209.17 g/mol, XLogP of -0.26, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethylsulfonyl sulfite is sourced from PubChem (CID 167019443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).