C25H25Cl2FN4O2S — CID 167020577
7-chloro-8-(4-chloro-3-fluorophenyl)-4-[(2S)-2-methyl-4-(prop-2-enoxymethyl)piperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (PubChem CID 167020577) has the molecular formula C25H25Cl2FN4O2S and a molecular weight of 535.47 g/mol. Its IUPAC name is 7-chloro-8-(4-chloro-3-fluorophenyl)-4-[(2S)-2-methyl-4-(prop-2-enoxymethyl)piperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one.
| Compound Name | 7-chloro-8-(4-chloro-3-fluorophenyl)-4-[(2S)-2-methyl-4-(prop-2-enoxymethyl)piperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
|---|---|
| PubChem CID | 167020577 |
| Molecular Formula | C25H25Cl2FN4O2S |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 7-chloro-8-(4-chloro-3-fluorophenyl)-4-[(2S)-2-methyl-4-(prop-2-enoxymethyl)piperazin-1-yl]-10-thia-1,3-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| SMILES | C=CCOCN1CCN(c2nc(=O)n3c4c(c(-c5ccc(Cl)c(F)c5)c(Cl)cc24)SCC3)[C@@H](C)C1 |
| InChI | InChI=1S/C25H25Cl2FN4O2S/c1-3-9-34-14-30-6-7-31(15(2)13-30)24-17-12-19(27)21(16-4-5-18(26)20(28)11-16)23-22(17)32(8-10-35-23)25(33)29-24/h3-5,11-12,15H,1,6-10,13-14H2,2H3/t15-/m0/s1 |
| InChIKey | WTPGAJFAPCNILU-HNNXBMFYSA-N |
| XLogP | 5.29 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|