C21H26N2O8S — CID 167027295
methyl 2-acetamido-3-[2-(acetyloxymethyl)-6-benzamido-5-oxooxan-3-yl]sulfanylpropanoate (PubChem CID 167027295) has the molecular formula C21H26N2O8S and a molecular weight of 466.51 g/mol. Its IUPAC name is methyl 2-acetamido-3-[2-(acetyloxymethyl)-6-benzamido-5-oxooxan-3-yl]sulfanylpropanoate.
| Compound Name | methyl 2-acetamido-3-[2-(acetyloxymethyl)-6-benzamido-5-oxooxan-3-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 167027295 |
| Molecular Formula | C21H26N2O8S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | methyl 2-acetamido-3-[2-(acetyloxymethyl)-6-benzamido-5-oxooxan-3-yl]sulfanylpropanoate |
| SMILES | COC(=O)C(CSC1CC(=O)C(NC(=O)c2ccccc2)OC1COC(C)=O)NC(C)=O |
| InChI | InChI=1S/C21H26N2O8S/c1-12(24)22-15(21(28)29-3)11-32-18-9-16(26)20(31-17(18)10-30-13(2)25)23-19(27)14-7-5-4-6-8-14/h4-8,15,17-18,20H,9-11H2,1-3H3,(H,22,24)(H,23,27) |
| InChIKey | HEVZMYGKOIWOHL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |