C21H27NO8S — CID 165012869
methyl (2R)-2-benzamido-3-[(2S,3S,4R,5R)-3,4-diacetyloxy-5-methyloxan-2-yl]sulfanylpropanoate (PubChem CID 165012869) has the molecular formula C21H27NO8S and a molecular weight of 453.51 g/mol. Its IUPAC name is methyl (2R)-2-benzamido-3-[(2S,3S,4R,5R)-3,4-diacetyloxy-5-methyloxan-2-yl]sulfanylpropanoate.
| Compound Name | methyl (2R)-2-benzamido-3-[(2S,3S,4R,5R)-3,4-diacetyloxy-5-methyloxan-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 165012869 |
| Molecular Formula | C21H27NO8S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | methyl (2R)-2-benzamido-3-[(2S,3S,4R,5R)-3,4-diacetyloxy-5-methyloxan-2-yl]sulfanylpropanoate |
| SMILES | COC(=O)[C@H](CS[C@@H]1OC[C@@H](C)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H27NO8S/c1-12-10-28-21(18(30-14(3)24)17(12)29-13(2)23)31-11-16(20(26)27-4)22-19(25)15-8-6-5-7-9-15/h5-9,12,16-18,21H,10-11H2,1-4H3,(H,22,25)/t12-,16+,17-,18+,21+/m1/s1 |
| InChIKey | JYTWIGJSERHKFN-IULXSRMISA-N |
| XLogP | 1.55 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|