C26H21NO11S — CID 102108362
methyl 2-benzamido-3-[2,3,4-trihydroxy-6-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl]sulfanylpropanoate (PubChem CID 102108362) has the molecular formula C26H21NO11S and a molecular weight of 555.52 g/mol. Its IUPAC name is methyl 2-benzamido-3-[2,3,4-trihydroxy-6-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-benzamido-3-[2,3,4-trihydroxy-6-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 102108362 |
| Molecular Formula | C26H21NO11S |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | methyl 2-benzamido-3-[2,3,4-trihydroxy-6-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl]sulfanylpropanoate |
| SMILES | COC(=O)C(CSc1c(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc(O)c(O)c1O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21NO11S/c1-37-26(36)14(27-25(35)11-5-3-2-4-6-11)10-39-24-13(9-16(30)19(31)22(24)34)23-21(33)20(32)18-15(29)7-12(28)8-17(18)38-23/h2-9,14,28-31,33-34H,10H2,1H3,(H,27,35) |
| InChIKey | JRIUPTQWNKCVSP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 206.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|