C26H27N3O4 — CID 167028092
3-[(Z)-4-(2-benzylphenoxy)-3-methylbut-2-enyl]-5-hydroxy-1-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 167028092) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 3-[(Z)-4-(2-benzylphenoxy)-3-methylbut-2-enyl]-5-hydroxy-1-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-[(Z)-4-(2-benzylphenoxy)-3-methylbut-2-enyl]-5-hydroxy-1-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 167028092 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3-[(Z)-4-(2-benzylphenoxy)-3-methylbut-2-enyl]-5-hydroxy-1-methyl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | C/C(=C/CN1CN(C)n2ccc(=O)c(O)c2C1=O)COc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C26H27N3O4/c1-19(17-33-23-11-7-6-10-21(23)16-20-8-4-3-5-9-20)12-14-28-18-27(2)29-15-13-22(30)25(31)24(29)26(28)32/h3-13,15,31H,14,16-18H2,1-2H3/b19-12- |
| InChIKey | CJZOIAZWDAOLLO-UNOMPAQXSA-N |
| XLogP | 3.15 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|