C26H26ClN3O4 — CID 167028123
3-[(Z)-6-(2-benzyl-5-chlorophenoxy)hex-3-enyl]-5-hydroxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 167028123) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is 3-[(Z)-6-(2-benzyl-5-chlorophenoxy)hex-3-enyl]-5-hydroxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-[(Z)-6-(2-benzyl-5-chlorophenoxy)hex-3-enyl]-5-hydroxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 167028123 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-[(Z)-6-(2-benzyl-5-chlorophenoxy)hex-3-enyl]-5-hydroxy-1,2-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2NCN1CC/C=C\CCOc1cc(Cl)ccc1Cc1ccccc1 |
| InChI | InChI=1S/C26H26ClN3O4/c27-21-11-10-20(16-19-8-4-3-5-9-19)23(17-21)34-15-7-2-1-6-13-29-18-28-30-14-12-22(31)25(32)24(30)26(29)33/h1-5,8-12,14,17,28,32H,6-7,13,15-16,18H2/b2-1- |
| InChIKey | QFXTVYAQHGNSRD-UPHRSURJSA-N |
| XLogP | 4.17 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|