C24H21ClFN3O4 — CID 147573781
1-benzyl-3-[(E)-4-(2-chloro-3-fluorophenoxy)but-2-enyl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 147573781) has the molecular formula C24H21ClFN3O4 and a molecular weight of 469.90 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-4-(2-chloro-3-fluorophenoxy)but-2-enyl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-benzyl-3-[(E)-4-(2-chloro-3-fluorophenoxy)but-2-enyl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 147573781 |
| Molecular Formula | C24H21ClFN3O4 |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1-benzyl-3-[(E)-4-(2-chloro-3-fluorophenoxy)but-2-enyl]-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1c2c(O)c(=O)ccn2N(Cc2ccccc2)CN1C/C=C/COc1cccc(F)c1Cl |
| InChI | InChI=1S/C24H21ClFN3O4/c25-21-18(26)9-6-10-20(21)33-14-5-4-12-27-16-28(15-17-7-2-1-3-8-17)29-13-11-19(30)23(31)22(29)24(27)32/h1-11,13,31H,12,14-16H2/b5-4+ |
| InChIKey | FVBDJFQGVJWAIL-SNAWJCMRSA-N |
| XLogP | 3.53 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|