C31H26FN3O3 — CID 163595003
3-benzyl-1-(3-fluoro-2-methyl-9a,10-dihydro-9H-indeno[1,2-a]inden-4b-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 163595003) has the molecular formula C31H26FN3O3 and a molecular weight of 507.57 g/mol. Its IUPAC name is 3-benzyl-1-(3-fluoro-2-methyl-9a,10-dihydro-9H-indeno[1,2-a]inden-4b-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 3-benzyl-1-(3-fluoro-2-methyl-9a,10-dihydro-9H-indeno[1,2-a]inden-4b-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 163595003 |
| Molecular Formula | C31H26FN3O3 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 3-benzyl-1-(3-fluoro-2-methyl-9a,10-dihydro-9H-indeno[1,2-a]inden-4b-yl)-5-hydroxy-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | Cc1cc2c(cc1F)C1(N3CN(Cc4ccccc4)C(=O)c4c(O)c(=O)ccn43)c3ccccc3CC1C2 |
| InChI | InChI=1S/C31H26FN3O3/c1-19-13-22-15-23-14-21-9-5-6-10-24(21)31(23,25(22)16-26(19)32)35-18-33(17-20-7-3-2-4-8-20)30(38)28-29(37)27(36)11-12-34(28)35/h2-13,16,23,37H,14-15,17-18H2,1H3 |
| InChIKey | MCBWKGOWQAXRKG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |