C8H16INO — CID 167029059
4-(3-iodopropyl)-2,2-dimethyl-1,3-oxazolidine (PubChem CID 167029059) has the molecular formula C8H16INO and a molecular weight of 269.13 g/mol. Its IUPAC name is 4-(3-iodopropyl)-2,2-dimethyl-1,3-oxazolidine.
| Compound Name | 4-(3-iodopropyl)-2,2-dimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 167029059 |
| Molecular Formula | C8H16INO |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 4-(3-iodopropyl)-2,2-dimethyl-1,3-oxazolidine |
| SMILES | CC1(C)NC(CCCI)CO1 |
| InChI | InChI=1S/C8H16INO/c1-8(2)10-7(6-11-8)4-3-5-9/h7,10H,3-6H2,1-2H3 |
| InChIKey | MVWBLDRSYHIYKX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|