C6H13NO2 — CID 97178926
[(4S)-2,2-dimethyl-1,3-oxazolidin-4-yl]methanol (PubChem CID 97178926) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-1,3-oxazolidin-4-yl]methanol.
| Compound Name | [(4S)-2,2-dimethyl-1,3-oxazolidin-4-yl]methanol |
|---|---|
| PubChem CID | 97178926 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-oxazolidin-4-yl]methanol |
| SMILES | CC1(C)N[C@@H](CO)CO1 |
| InChI | InChI=1S/C6H13NO2/c1-6(2)7-5(3-8)4-9-6/h5,7-8H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | DJZHDMBGZISZGK-YFKPBYRVSA-N |
| XLogP | -0.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |