C21H26N6O2S — CID 167033609
2-[(2S,5R)-2-[5-[(Z)-1-amino-3-iminoprop-1-enyl]thiophen-2-yl]-5-methylpiperidin-1-yl]-N-(6-amino-5-methyl-3-pyridinyl)-2-oxoacetamide (PubChem CID 167033609) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 2-[(2S,5R)-2-[5-[(Z)-1-amino-3-iminoprop-1-enyl]thiophen-2-yl]-5-methylpiperidin-1-yl]-N-(6-amino-5-methyl-3-pyridinyl)-2-oxoacetamide.
| Compound Name | 2-[(2S,5R)-2-[5-[(Z)-1-amino-3-iminoprop-1-enyl]thiophen-2-yl]-5-methylpiperidin-1-yl]-N-(6-amino-5-methyl-3-pyridinyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 167033609 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[(2S,5R)-2-[5-[(Z)-1-amino-3-iminoprop-1-enyl]thiophen-2-yl]-5-methylpiperidin-1-yl]-N-(6-amino-5-methyl-3-pyridinyl)-2-oxoacetamide |
| SMILES | [H]/N=C/C=C(\N)c1ccc([C@@H]2CC[C@@H](C)CN2C(=O)C(=O)Nc2cnc(N)c(C)c2)s1 |
| InChI | InChI=1S/C21H26N6O2S/c1-12-3-4-16(18-6-5-17(30-18)15(23)7-8-22)27(11-12)21(29)20(28)26-14-9-13(2)19(24)25-10-14/h5-10,12,16,22H,3-4,11,23H2,1-2H3,(H2,24,25)(H,26,28)/b15-7-,22-8+/t12-,16+/m1/s1 |
| InChIKey | LYHHBRQAXPHQMS-ZMGZOKHDSA-N |
| XLogP | 2.92 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|