C16H17FN2O4S — CID 167036461
1-[(3R,5R)-5-fluoro-3-hydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 167036461) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[(3R,5R)-5-fluoro-3-hydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(3R,5R)-5-fluoro-3-hydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 167036461 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-[(3R,5R)-5-fluoro-3-hydroxy-5-(phenylmethoxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | O=c1ccn(C2O[C@](F)(COCc3ccccc3)C[C@H]2O)c(=S)[nH]1 |
| InChI | InChI=1S/C16H17FN2O4S/c17-16(10-22-9-11-4-2-1-3-5-11)8-12(20)14(23-16)19-7-6-13(21)18-15(19)24/h1-7,12,14,20H,8-10H2,(H,18,21,24)/t12-,14?,16+/m1/s1 |
| InChIKey | YZDVIGLTOFTRLN-LGKIWNRFSA-N |
| XLogP | 2.07 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|