About (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane
(5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane (PubChem CID 167037825) has the molecular formula C8H15FN2
and a molecular weight of 158.22 g/mol. Its IUPAC name is (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane |
| PubChem CID | 167037825 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane |
| SMILES | CN1CC2(CCN[C@H]2CF)C1 |
| InChI | InChI=1S/C8H15FN2/c1-11-5-8(6-11)2-3-10-7(8)4-9/h7,10H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | ZHOONBBMJKMFMQ-ZETCQYMHSA-N |
| XLogP | 0.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane?
The IUPAC name of (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane (CID 167037825) is (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane.
What is the SMILES notation for (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane?
The canonical SMILES for (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane is CN1CC2(CCN[C@H]2CF)C1.
What is the InChIKey of (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane?
The InChIKey is ZHOONBBMJKMFMQ-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H15FN2/c1-11-5-8(6-11)2-3-10-7(8)4-9/h7,10H,2-6H2,1H3/t7-/m0/s1.
What are the key properties of (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane?
(5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane has a molecular weight of 158.22 g/mol, XLogP of 0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(fluoromethyl)-2-methyl-2,6-diazaspiro[3.4]octane is sourced from PubChem (CID 167037825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).