C27H32ClN3O3 — CID 167037893
1-[7-[4-(2-chloro-5-hydroxy-3-methylphenyl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one (PubChem CID 167037893) has the molecular formula C27H32ClN3O3 and a molecular weight of 482.02 g/mol. Its IUPAC name is 1-[7-[4-(2-chloro-5-hydroxy-3-methylphenyl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[4-(2-chloro-5-hydroxy-3-methylphenyl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167037893 |
| Molecular Formula | C27H32ClN3O3 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 1-[7-[4-(2-chloro-5-hydroxy-3-methylphenyl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2(CCN(c3nc4c(c(-c5cc(O)cc(C)c5Cl)c3C)COC(C)(C)C4)C2)C1 |
| InChI | InChI=1S/C27H32ClN3O3/c1-6-22(33)31-14-27(15-31)7-8-30(13-27)25-17(3)23(19-10-18(32)9-16(2)24(19)28)20-12-34-26(4,5)11-21(20)29-25/h6,9-10,32H,1,7-8,11-15H2,2-5H3 |
| InChIKey | WSIGKPHXPPCBJD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|