C17H24ClN3O2 — CID 167041330
7-(4-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydrofuro[2,3-d]pyridazin-4-amine (PubChem CID 167041330) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydrofuro[2,3-d]pyridazin-4-amine.
| Compound Name | 7-(4-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydrofuro[2,3-d]pyridazin-4-amine |
|---|---|
| PubChem CID | 167041330 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 7-(4-chlorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydrofuro[2,3-d]pyridazin-4-amine |
| SMILES | Clc1ccc(C2NNC(NC[C@H]3CCCO3)C3CCOC23)cc1 |
| InChI | InChI=1S/C17H24ClN3O2/c18-12-5-3-11(4-6-12)15-16-14(7-9-23-16)17(21-20-15)19-10-13-2-1-8-22-13/h3-6,13-17,19-21H,1-2,7-10H2/t13-,14?,15?,16?,17?/m1/s1 |
| InChIKey | WHEVCZZUMRXIPT-CWJHNBGESA-N |
| XLogP | 1.99 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |