C18H27ClN4O — CID 167041315
4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[3,4-d]pyridazin-1-amine (PubChem CID 167041315) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[3,4-d]pyridazin-1-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[3,4-d]pyridazin-1-amine |
|---|---|
| PubChem CID | 167041315 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[3,4-d]pyridazin-1-amine |
| SMILES | Clc1ccc(C2NNC(NCC3CCCO3)C3CCNCC23)cc1 |
| InChI | InChI=1S/C18H27ClN4O/c19-13-5-3-12(4-6-13)17-16-11-20-8-7-15(16)18(23-22-17)21-10-14-2-1-9-24-14/h3-6,14-18,20-23H,1-2,7-11H2 |
| InChIKey | KLJOHRDZUDAAKT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |