C19H32ClF3N4O — CID 164754438
1-[4-chloro-2-(trifluoromethyl)cyclohexyl]-N-[[(2R)-oxolan-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[3,4-d]pyridazin-4-amine (PubChem CID 164754438) has the molecular formula C19H32ClF3N4O and a molecular weight of 424.94 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)cyclohexyl]-N-[[(2R)-oxolan-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[3,4-d]pyridazin-4-amine.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)cyclohexyl]-N-[[(2R)-oxolan-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[3,4-d]pyridazin-4-amine |
|---|---|
| PubChem CID | 164754438 |
| Molecular Formula | C19H32ClF3N4O |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)cyclohexyl]-N-[[(2R)-oxolan-2-yl]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[3,4-d]pyridazin-4-amine |
| SMILES | FC(F)(F)C1CC(Cl)CCC1C1NNC(NC[C@H]2CCCO2)C2CNCCC21 |
| InChI | InChI=1S/C19H32ClF3N4O/c20-11-3-4-14(16(8-11)19(21,22)23)17-13-5-6-24-10-15(13)18(27-26-17)25-9-12-2-1-7-28-12/h11-18,24-27H,1-10H2/t11?,12-,13?,14?,15?,16?,17?,18?/m1/s1 |
| InChIKey | WIJYAGXJMFYFHZ-IBTOBYAESA-N |
| XLogP | 2.37 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|