C18H33ClN4O — CID 164754420
8-(4-chlorocyclohexyl)-N-(oxolan-2-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[2,3-d]pyridazin-5-amine (PubChem CID 164754420) has the molecular formula C18H33ClN4O and a molecular weight of 356.94 g/mol. Its IUPAC name is 8-(4-chlorocyclohexyl)-N-(oxolan-2-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[2,3-d]pyridazin-5-amine.
| Compound Name | 8-(4-chlorocyclohexyl)-N-(oxolan-2-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[2,3-d]pyridazin-5-amine |
|---|---|
| PubChem CID | 164754420 |
| Molecular Formula | C18H33ClN4O |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 8-(4-chlorocyclohexyl)-N-(oxolan-2-ylmethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydropyrido[2,3-d]pyridazin-5-amine |
| SMILES | ClC1CCC(C2NNC(NCC3CCCO3)C3CCCNC32)CC1 |
| InChI | InChI=1S/C18H33ClN4O/c19-13-7-5-12(6-8-13)16-17-15(4-1-9-20-17)18(23-22-16)21-11-14-3-2-10-24-14/h12-18,20-23H,1-11H2 |
| InChIKey | CCDMNMJJWPFBCK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|