C23H22ClFN4O3 — CID 167042386
N-[(2R)-1-[4-(5-chloro-2-fluorophenyl)phenyl]-3-(3-formyloxolan-3-yl)propan-2-yl]-2H-triazole-4-carboxamide (PubChem CID 167042386) has the molecular formula C23H22ClFN4O3 and a molecular weight of 456.91 g/mol. Its IUPAC name is N-[(2R)-1-[4-(5-chloro-2-fluorophenyl)phenyl]-3-(3-formyloxolan-3-yl)propan-2-yl]-2H-triazole-4-carboxamide.
| Compound Name | N-[(2R)-1-[4-(5-chloro-2-fluorophenyl)phenyl]-3-(3-formyloxolan-3-yl)propan-2-yl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 167042386 |
| Molecular Formula | C23H22ClFN4O3 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[(2R)-1-[4-(5-chloro-2-fluorophenyl)phenyl]-3-(3-formyloxolan-3-yl)propan-2-yl]-2H-triazole-4-carboxamide |
| SMILES | O=CC1(C[C@@H](Cc2ccc(-c3cc(Cl)ccc3F)cc2)NC(=O)c2cn[nH]n2)CCOC1 |
| InChI | InChI=1S/C23H22ClFN4O3/c24-17-5-6-20(25)19(10-17)16-3-1-15(2-4-16)9-18(11-23(13-30)7-8-32-14-23)27-22(31)21-12-26-29-28-21/h1-6,10,12-13,18H,7-9,11,14H2,(H,27,31)(H,26,28,29)/t18-,23?/m1/s1 |
| InChIKey | DAMPVQPLENAUJV-FKSKYRLFSA-N |
| XLogP | 3.60 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|