C27H45N — CID 167044219
13,13-dimethyl-11-methylidene-N-(4-phenylbut-1-en-2-yl)tetradecan-6-amine (PubChem CID 167044219) has the molecular formula C27H45N and a molecular weight of 383.66 g/mol. Its IUPAC name is 13,13-dimethyl-11-methylidene-N-(4-phenylbut-1-en-2-yl)tetradecan-6-amine.
| Compound Name | 13,13-dimethyl-11-methylidene-N-(4-phenylbut-1-en-2-yl)tetradecan-6-amine |
|---|---|
| PubChem CID | 167044219 |
| Molecular Formula | C27H45N |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 383.36 |
| IUPAC Name | 13,13-dimethyl-11-methylidene-N-(4-phenylbut-1-en-2-yl)tetradecan-6-amine |
| SMILES | C=C(CCCCC(CCCCC)NC(=C)CCc1ccccc1)CC(C)(C)C |
| InChI | InChI=1S/C27H45N/c1-7-8-10-18-26(19-14-13-15-23(2)22-27(4,5)6)28-24(3)20-21-25-16-11-9-12-17-25/h9,11-12,16-17,26,28H,2-3,7-8,10,13-15,18-22H2,1,4-6H3 |
| InChIKey | BBCNLBLXPOICLQ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|