C40H55N — CID 167044300
N-[5,5-bis(4-ethylphenyl)-2-methyl-5-phenylpentyl]-9-methylideneundec-1-en-2-amine (PubChem CID 167044300) has the molecular formula C40H55N and a molecular weight of 549.89 g/mol. Its IUPAC name is N-[5,5-bis(4-ethylphenyl)-2-methyl-5-phenylpentyl]-9-methylideneundec-1-en-2-amine.
| Compound Name | N-[5,5-bis(4-ethylphenyl)-2-methyl-5-phenylpentyl]-9-methylideneundec-1-en-2-amine |
|---|---|
| PubChem CID | 167044300 |
| Molecular Formula | C40H55N |
| Molecular Weight | 549.89 g/mol |
| Exact Mass | 549.43 |
| IUPAC Name | N-[5,5-bis(4-ethylphenyl)-2-methyl-5-phenylpentyl]-9-methylideneundec-1-en-2-amine |
| SMILES | C=C(CC)CCCCCCC(=C)NCC(C)CCC(c1ccccc1)(c1ccc(CC)cc1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C40H55N/c1-7-32(4)17-13-10-11-14-18-34(6)41-31-33(5)29-30-40(37-19-15-12-16-20-37,38-25-21-35(8-2)22-26-38)39-27-23-36(9-3)24-28-39/h12,15-16,19-28,33,41H,4,6-11,13-14,17-18,29-31H2,1-3,5H3 |
| InChIKey | DFCZPEQHRMCRKK-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.89 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|