C7H15F2N3O2S — CID 167049214
4-[2,2-difluoroethyl(sulfamoyl)amino]piperidine (PubChem CID 167049214) has the molecular formula C7H15F2N3O2S and a molecular weight of 243.28 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(sulfamoyl)amino]piperidine.
| Compound Name | 4-[2,2-difluoroethyl(sulfamoyl)amino]piperidine |
|---|---|
| PubChem CID | 167049214 |
| Molecular Formula | C7H15F2N3O2S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-[2,2-difluoroethyl(sulfamoyl)amino]piperidine |
| SMILES | NS(=O)(=O)N(CC(F)F)C1CCNCC1 |
| InChI | InChI=1S/C7H15F2N3O2S/c8-7(9)5-12(15(10,13)14)6-1-3-11-4-2-6/h6-7,11H,1-5H2,(H2,10,13,14) |
| InChIKey | HJRVHCKTHAUVSL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |