C69H52N4 — CID 167052041
2-(N-[8-(N-[2-cyano-6-[(3E)-hexa-1,3-dien-3-yl]-4-phenylphenyl]anilino)-11,11-dimethylbenzo[b]fluoren-2-yl]anilino)-3,5-diphenylbenzonitrile (PubChem CID 167052041) has the molecular formula C69H52N4 and a molecular weight of 937.20 g/mol. Its IUPAC name is 2-(N-[8-(N-[2-cyano-6-[(3E)-hexa-1,3-dien-3-yl]-4-phenylphenyl]anilino)-11,11-dimethylbenzo[b]fluoren-2-yl]anilino)-3,5-diphenylbenzonitrile.
| Compound Name | 2-(N-[8-(N-[2-cyano-6-[(3E)-hexa-1,3-dien-3-yl]-4-phenylphenyl]anilino)-11,11-dimethylbenzo[b]fluoren-2-yl]anilino)-3,5-diphenylbenzonitrile |
|---|---|
| PubChem CID | 167052041 |
| Molecular Formula | C69H52N4 |
| Molecular Weight | 937.20 g/mol |
| Exact Mass | 936.42 |
| IUPAC Name | 2-(N-[8-(N-[2-cyano-6-[(3E)-hexa-1,3-dien-3-yl]-4-phenylphenyl]anilino)-11,11-dimethylbenzo[b]fluoren-2-yl]anilino)-3,5-diphenylbenzonitrile |
| SMILES | C=C/C(=C\CC)c1cc(-c2ccccc2)cc(C#N)c1N(c1ccccc1)c1ccc2cc3c(cc2c1)C(C)(C)c1cc(N(c2ccccc2)c2c(C#N)cc(-c4ccccc4)cc2-c2ccccc2)ccc1-3 |
| InChI | InChI=1S/C69H52N4/c1-5-22-47(6-2)62-41-52(48-23-12-7-13-24-48)37-55(45-70)67(62)72(57-29-18-10-19-30-57)59-34-33-51-40-64-61-36-35-60(44-66(61)69(3,4)65(64)43-54(51)39-59)73(58-31-20-11-21-32-58)68-56(46-71)38-53(49-25-14-8-15-26-49)42-63(68)50-27-16-9-17-28-50/h6-44H,2,5H2,1,3-4H3/b47-22+ |
| InChIKey | VYHFRSLJBAXSDK-CMKTUTQASA-N |
| XLogP | 18.81 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.20 |
| LogP ≤ 5 | 18.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|