C9H11BrN4 — CID 167052639
8-bromo-5-ethyl-6H-pyrido[2,1-f][1,2,4]triazin-4-amine (PubChem CID 167052639) has the molecular formula C9H11BrN4 and a molecular weight of 255.12 g/mol. Its IUPAC name is 8-bromo-5-ethyl-6H-pyrido[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 8-bromo-5-ethyl-6H-pyrido[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 167052639 |
| Molecular Formula | C9H11BrN4 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 8-bromo-5-ethyl-6H-pyrido[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCC1=C2C(N)=NC=NN2C(Br)=CC1 |
| InChI | InChI=1S/C9H11BrN4/c1-2-6-3-4-7(10)14-8(6)9(11)12-5-13-14/h4-5H,2-3H2,1H3,(H2,11,12,13) |
| InChIKey | SPMIQOORMSIFPZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|