C15H24O5S — CID 167054074
(2Z)-2-(5-methyl-5-octyl-1,1,3-trioxothiolan-2-ylidene)acetic acid (PubChem CID 167054074) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is (2Z)-2-(5-methyl-5-octyl-1,1,3-trioxothiolan-2-ylidene)acetic acid.
| Compound Name | (2Z)-2-(5-methyl-5-octyl-1,1,3-trioxothiolan-2-ylidene)acetic acid |
|---|---|
| PubChem CID | 167054074 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2Z)-2-(5-methyl-5-octyl-1,1,3-trioxothiolan-2-ylidene)acetic acid |
| SMILES | CCCCCCCCC1(C)CC(=O)/C(=C/C(=O)O)S1(=O)=O |
| InChI | InChI=1S/C15H24O5S/c1-3-4-5-6-7-8-9-15(2)11-12(16)13(10-14(17)18)21(15,19)20/h10H,3-9,11H2,1-2H3,(H,17,18)/b13-10- |
| InChIKey | UXCBSCSIQWBCAE-RAXLEYEMSA-N |
| XLogP | 2.85 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|