C20H32N4O3 — CID 167059185
tert-butyl (2R)-3-azido-2-[[(2E,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 167059185) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl (2R)-3-azido-2-[[(2E,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-3-azido-2-[[(2E,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167059185 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | tert-butyl (2R)-3-azido-2-[[(2E,4Z)-5-propan-2-ylhepta-2,4,6-trien-2-yl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | C=C/C(=C\C=C(/C)OC[C@H]1C(N=[N+]=[N-])CCN1C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C20H32N4O3/c1-8-16(14(2)3)10-9-15(4)26-13-18-17(22-23-21)11-12-24(18)19(25)27-20(5,6)7/h8-10,14,17-18H,1,11-13H2,2-7H3/b15-9+,16-10+/t17?,18-/m0/s1 |
| InChIKey | RPFMKQZSPBGYII-MVRPSMRRSA-N |
| XLogP | 5.36 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|