C26H35N5O9S — CID 167060042
3-[1-[3-(4-butanimidoyl-6-oxo-1H-pyrimidin-2-yl)-4-ethoxyphenyl]sulfonylazetidin-3-yl]propyl 4-nitrooxybutanoate (PubChem CID 167060042) has the molecular formula C26H35N5O9S and a molecular weight of 593.66 g/mol. Its IUPAC name is 3-[1-[3-(4-butanimidoyl-6-oxo-1H-pyrimidin-2-yl)-4-ethoxyphenyl]sulfonylazetidin-3-yl]propyl 4-nitrooxybutanoate.
| Compound Name | 3-[1-[3-(4-butanimidoyl-6-oxo-1H-pyrimidin-2-yl)-4-ethoxyphenyl]sulfonylazetidin-3-yl]propyl 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 167060042 |
| Molecular Formula | C26H35N5O9S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 3-[1-[3-(4-butanimidoyl-6-oxo-1H-pyrimidin-2-yl)-4-ethoxyphenyl]sulfonylazetidin-3-yl]propyl 4-nitrooxybutanoate |
| SMILES | [H]/N=C(\CCC)c1cc(=O)[nH]c(-c2cc(S(=O)(=O)N3CC(CCCOC(=O)CCCO[N+](=O)[O-])C3)ccc2OCC)n1 |
| InChI | InChI=1S/C26H35N5O9S/c1-3-7-21(27)22-15-24(32)29-26(28-22)20-14-19(10-11-23(20)38-4-2)41(36,37)30-16-18(17-30)8-5-12-39-25(33)9-6-13-40-31(34)35/h10-11,14-15,18,27H,3-9,12-13,16-17H2,1-2H3,(H,28,29,32)/b27-21+ |
| InChIKey | OSEWDGDUTDZWBH-SZXQPVLSSA-N |
| XLogP | 2.94 |
| TPSA | 194.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|