C31H47N7O10S — CID 156738899
4-butanimidoyl-2-[2-ethoxy-5-[3-(3-methoxypropyl)azetidin-1-yl]sulfanylphenyl]-5-(methylamino)-1H-pyrimidin-6-one;(1-nitrooxy-7-oxoheptan-2-yl) nitrate (PubChem CID 156738899) has the molecular formula C31H47N7O10S and a molecular weight of 709.82 g/mol. Its IUPAC name is 4-butanimidoyl-2-[2-ethoxy-5-[3-(3-methoxypropyl)azetidin-1-yl]sulfanylphenyl]-5-(methylamino)-1H-pyrimidin-6-one;(1-nitrooxy-7-oxoheptan-2-yl) nitrate.
| Compound Name | 4-butanimidoyl-2-[2-ethoxy-5-[3-(3-methoxypropyl)azetidin-1-yl]sulfanylphenyl]-5-(methylamino)-1H-pyrimidin-6-one;(1-nitrooxy-7-oxoheptan-2-yl) nitrate |
|---|---|
| PubChem CID | 156738899 |
| Molecular Formula | C31H47N7O10S |
| Molecular Weight | 709.82 g/mol |
| Exact Mass | 709.31 |
| IUPAC Name | 4-butanimidoyl-2-[2-ethoxy-5-[3-(3-methoxypropyl)azetidin-1-yl]sulfanylphenyl]-5-(methylamino)-1H-pyrimidin-6-one;(1-nitrooxy-7-oxoheptan-2-yl) nitrate |
| SMILES | O=CCCCCC(CO[N+](=O)[O-])O[N+](=O)[O-].[H]/N=C(\CCC)c1nc(-c2cc(SN3CC(CCCOC)C3)ccc2OCC)[nH]c(=O)c1NC |
| InChI | InChI=1S/C24H35N5O3S.C7H12N2O7/c1-5-8-19(25)21-22(26-3)24(30)28-23(27-21)18-13-17(10-11-20(18)32-6-2)33-29-14-16(15-29)9-7-12-31-4;10-5-3-1-2-4-7(16-9(13)14)6-15-8(11)12/h10-11,13,16,25-26H,5-9,12,14-15H2,1-4H3,(H,27,28,30);5,7H,1-4,6H2/b25-19+; |
| InChIKey | WJIDXUADSHGAEP-LUINMZRLSA-N |
| XLogP | 4.94 |
| TPSA | 225.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|