C25H32N4O3 — CID 144690230
2-[4-[3-[4-butanimidoyl-5-(methylamino)-6-oxo-1H-pyrimidin-2-yl]-4-ethoxyphenyl]cyclohex-3-en-1-yl]acetaldehyde (PubChem CID 144690230) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[4-[3-[4-butanimidoyl-5-(methylamino)-6-oxo-1H-pyrimidin-2-yl]-4-ethoxyphenyl]cyclohex-3-en-1-yl]acetaldehyde.
| Compound Name | 2-[4-[3-[4-butanimidoyl-5-(methylamino)-6-oxo-1H-pyrimidin-2-yl]-4-ethoxyphenyl]cyclohex-3-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 144690230 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-[4-[3-[4-butanimidoyl-5-(methylamino)-6-oxo-1H-pyrimidin-2-yl]-4-ethoxyphenyl]cyclohex-3-en-1-yl]acetaldehyde |
| SMILES | [H]/N=C(\CCC)c1nc(-c2cc(C3=CCC(CC=O)CC3)ccc2OCC)[nH]c(=O)c1NC |
| InChI | InChI=1S/C25H32N4O3/c1-4-6-20(26)22-23(27-3)25(31)29-24(28-22)19-15-18(11-12-21(19)32-5-2)17-9-7-16(8-10-17)13-14-30/h9,11-12,14-16,26-27H,4-8,10,13H2,1-3H3,(H,28,29,31)/b26-20+ |
| InChIKey | MHAPXXJHNMIXEN-LHLOQNFPSA-N |
| XLogP | 4.82 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|