C25H25FN6O3 — CID 167062286
3-[4-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[4,3-c]pyridazin-6-one (PubChem CID 167062286) has the molecular formula C25H25FN6O3 and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-[4-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[4,3-c]pyridazin-6-one.
| Compound Name | 3-[4-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[4,3-c]pyridazin-6-one |
|---|---|
| PubChem CID | 167062286 |
| Molecular Formula | C25H25FN6O3 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3-[4-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]-5-(2-fluoro-6-methoxyphenyl)-1H-pyrazolo[4,3-c]pyridazin-6-one |
| SMILES | COc1cccc(F)c1-n1nc2c(-c3ccc(N4CCN5CCOC[C@@H]5C4)cc3)n[nH]c2cc1=O |
| InChI | InChI=1S/C25H25FN6O3/c1-34-21-4-2-3-19(26)25(21)32-22(33)13-20-24(29-32)23(28-27-20)16-5-7-17(8-6-16)31-10-9-30-11-12-35-15-18(30)14-31/h2-8,13,18,27H,9-12,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | GETDICAAXVOEAE-SFHVURJKSA-N |
| XLogP | 2.44 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |