C25H31FN6O3 — CID 169422987
3-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]-5-(2-fluoro-6-methoxyphenyl)-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one (PubChem CID 169422987) has the molecular formula C25H31FN6O3 and a molecular weight of 482.56 g/mol. Its IUPAC name is 3-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]-5-(2-fluoro-6-methoxyphenyl)-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one.
| Compound Name | 3-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]-5-(2-fluoro-6-methoxyphenyl)-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one |
|---|---|
| PubChem CID | 169422987 |
| Molecular Formula | C25H31FN6O3 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 3-[4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]-5-(2-fluoro-6-methoxyphenyl)-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one |
| SMILES | COc1cccc(F)c1N1NC2C(CC1=O)NNC2c1ccc(N2CCN3CCOC[C@H]3C2)cc1 |
| InChI | InChI=1S/C25H31FN6O3/c1-34-21-4-2-3-19(26)25(21)32-22(33)13-20-24(29-32)23(28-27-20)16-5-7-17(8-6-16)31-10-9-30-11-12-35-15-18(30)14-31/h2-8,18,20,23-24,27-29H,9-15H2,1H3/t18-,20?,23?,24?/m1/s1 |
| InChIKey | JECIFLFTPPWUNL-GNVJUJJRSA-N |
| XLogP | 1.18 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|