C26H30FN7O3 — CID 169422937
3-fluoro-5-methoxy-4-[3-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-6-oxo-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-5-yl]benzonitrile (PubChem CID 169422937) has the molecular formula C26H30FN7O3 and a molecular weight of 507.57 g/mol. Its IUPAC name is 3-fluoro-5-methoxy-4-[3-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-6-oxo-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-5-yl]benzonitrile.
| Compound Name | 3-fluoro-5-methoxy-4-[3-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-6-oxo-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 169422937 |
| Molecular Formula | C26H30FN7O3 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 3-fluoro-5-methoxy-4-[3-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-6-oxo-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-5-yl]benzonitrile |
| SMILES | COc1cc(C#N)cc(F)c1N1NC2C(CC1=O)NNC2c1ccc(N2CCN(C3COC3)CC2)cc1 |
| InChI | InChI=1S/C26H30FN7O3/c1-36-22-11-16(13-28)10-20(27)26(22)34-23(35)12-21-25(31-34)24(30-29-21)17-2-4-18(5-3-17)32-6-8-33(9-7-32)19-14-37-15-19/h2-5,10-11,19,21,24-25,29-31H,6-9,12,14-15H2,1H3 |
| InChIKey | YUVJJABJELJQEO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|