C23H28ClFN6O — CID 169422930
5-(4-chloro-2-fluoro-6-methylphenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one (PubChem CID 169422930) has the molecular formula C23H28ClFN6O and a molecular weight of 458.97 g/mol. Its IUPAC name is 5-(4-chloro-2-fluoro-6-methylphenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one.
| Compound Name | 5-(4-chloro-2-fluoro-6-methylphenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one |
|---|---|
| PubChem CID | 169422930 |
| Molecular Formula | C23H28ClFN6O |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 5-(4-chloro-2-fluoro-6-methylphenyl)-3-[4-(4-methylpiperazin-1-yl)phenyl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one |
| SMILES | Cc1cc(Cl)cc(F)c1N1NC2C(CC1=O)NNC2c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C23H28ClFN6O/c1-14-11-16(24)12-18(25)23(14)31-20(32)13-19-22(28-31)21(27-26-19)15-3-5-17(6-4-15)30-9-7-29(2)8-10-30/h3-6,11-12,19,21-22,26-28H,7-10,13H2,1-2H3 |
| InChIKey | JSDYQZJTEXKOME-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|