C23H31N7O2 — CID 169422948
5-(2-methoxy-6-methylphenyl)-3-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one (PubChem CID 169422948) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 5-(2-methoxy-6-methylphenyl)-3-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one.
| Compound Name | 5-(2-methoxy-6-methylphenyl)-3-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one |
|---|---|
| PubChem CID | 169422948 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 5-(2-methoxy-6-methylphenyl)-3-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-2,3,3a,4,7,7a-hexahydro-1H-pyrazolo[4,3-c]pyridazin-6-one |
| SMILES | COc1cccc(C)c1N1NC2C(CC1=O)NNC2c1ccc(N2CCN(C)CC2)nc1 |
| InChI | InChI=1S/C23H31N7O2/c1-15-5-4-6-18(32-3)23(15)30-20(31)13-17-22(27-30)21(26-25-17)16-7-8-19(24-14-16)29-11-9-28(2)10-12-29/h4-8,14,17,21-22,25-27H,9-13H2,1-3H3 |
| InChIKey | LLZPAJUQDUWKQT-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |