C39H54O18 — CID 167063507
12-O-(1,3-dicarboxyoxypropan-2-yl) 1-O-[[6-methoxy-5-[(E)-6-methoxy-3-methyl-6-oxohex-2-enyl]-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxycarbonyloxymethyl] 2,10-dimethyldodecanedioate (PubChem CID 167063507) has the molecular formula C39H54O18 and a molecular weight of 810.84 g/mol. Its IUPAC name is 12-O-(1,3-dicarboxyoxypropan-2-yl) 1-O-[[6-methoxy-5-[(E)-6-methoxy-3-methyl-6-oxohex-2-enyl]-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxycarbonyloxymethyl] 2,10-dimethyldodecanedioate.
| Compound Name | 12-O-(1,3-dicarboxyoxypropan-2-yl) 1-O-[[6-methoxy-5-[(E)-6-methoxy-3-methyl-6-oxohex-2-enyl]-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxycarbonyloxymethyl] 2,10-dimethyldodecanedioate |
|---|---|
| PubChem CID | 167063507 |
| Molecular Formula | C39H54O18 |
| Molecular Weight | 810.84 g/mol |
| Exact Mass | 810.33 |
| IUPAC Name | 12-O-(1,3-dicarboxyoxypropan-2-yl) 1-O-[[6-methoxy-5-[(E)-6-methoxy-3-methyl-6-oxohex-2-enyl]-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxycarbonyloxymethyl] 2,10-dimethyldodecanedioate |
| SMILES | COC(=O)CC/C(C)=C/Cc1c(OC)c(C)c2c(c1OC(=O)OCOC(=O)C(C)CCCCCCCC(C)CC(=O)OC(COC(=O)O)COC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C39H54O18/c1-23(15-17-30(40)49-5)14-16-28-33(50-6)26(4)29-21-51-36(43)32(29)34(28)57-39(48)55-22-54-35(42)25(3)13-11-9-7-8-10-12-24(2)18-31(41)56-27(19-52-37(44)45)20-53-38(46)47/h14,24-25,27H,7-13,15-22H2,1-6H3,(H,44,45)(H,46,47)/b23-14+ |
| InChIKey | KDMGJOMZSRECMB-OEAKJJBVSA-N |
| XLogP | 6.83 |
| TPSA | 243.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.84 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|