C39H52O10 — CID 158786764
12-[4-[[6-methoxy-5-(6-methoxy-3-methyl-6-oxohex-2-enyl)-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxymethyl]phenoxy]-3,11-dimethyl-12-oxododecanoic acid (PubChem CID 158786764) has the molecular formula C39H52O10 and a molecular weight of 680.84 g/mol. Its IUPAC name is 12-[4-[[6-methoxy-5-(6-methoxy-3-methyl-6-oxohex-2-enyl)-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxymethyl]phenoxy]-3,11-dimethyl-12-oxododecanoic acid.
| Compound Name | 12-[4-[[6-methoxy-5-(6-methoxy-3-methyl-6-oxohex-2-enyl)-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxymethyl]phenoxy]-3,11-dimethyl-12-oxododecanoic acid |
|---|---|
| PubChem CID | 158786764 |
| Molecular Formula | C39H52O10 |
| Molecular Weight | 680.84 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | 12-[4-[[6-methoxy-5-(6-methoxy-3-methyl-6-oxohex-2-enyl)-7-methyl-3-oxo-1H-2-benzofuran-4-yl]oxymethyl]phenoxy]-3,11-dimethyl-12-oxododecanoic acid |
| SMILES | COC(=O)CCC(C)=CCc1c(OC)c(C)c2c(c1OCc1ccc(OC(=O)C(C)CCCCCCCC(C)CC(=O)O)cc1)C(=O)OC2 |
| InChI | InChI=1S/C39H52O10/c1-25(15-21-34(42)45-5)14-20-31-36(46-6)28(4)32-24-48-39(44)35(32)37(31)47-23-29-16-18-30(19-17-29)49-38(43)27(3)13-11-9-7-8-10-12-26(2)22-33(40)41/h14,16-19,26-27H,7-13,15,20-24H2,1-6H3,(H,40,41) |
| InChIKey | IRTWWEZHDPIPFI-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.84 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|