C26H28O7 — CID 89424085
(E)-6-[6-methoxy-7-methyl-3-oxo-4-(1-phenylmethoxyethenoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 89424085) has the molecular formula C26H28O7 and a molecular weight of 452.50 g/mol. Its IUPAC name is (E)-6-[6-methoxy-7-methyl-3-oxo-4-(1-phenylmethoxyethenoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[6-methoxy-7-methyl-3-oxo-4-(1-phenylmethoxyethenoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 89424085 |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (E)-6-[6-methoxy-7-methyl-3-oxo-4-(1-phenylmethoxyethenoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | C=C(OCc1ccccc1)Oc1c(C/C=C(\C)CCC(=O)O)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C26H28O7/c1-16(11-13-22(27)28)10-12-20-24(30-4)17(2)21-15-32-26(29)23(21)25(20)33-18(3)31-14-19-8-6-5-7-9-19/h5-10H,3,11-15H2,1-2,4H3,(H,27,28)/b16-10+ |
| InChIKey | CYWVYBFNLWPDNI-MHWRWJLKSA-N |
| XLogP | 5.09 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|