C31H37NO10 — CID 71504408
(E)-6-[4-[5-[(3,4-dimethoxyphenyl)methylamino]-5-oxopentanoyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 71504408) has the molecular formula C31H37NO10 and a molecular weight of 583.63 g/mol. Its IUPAC name is (E)-6-[4-[5-[(3,4-dimethoxyphenyl)methylamino]-5-oxopentanoyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[4-[5-[(3,4-dimethoxyphenyl)methylamino]-5-oxopentanoyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 71504408 |
| Molecular Formula | C31H37NO10 |
| Molecular Weight | 583.63 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | (E)-6-[4-[5-[(3,4-dimethoxyphenyl)methylamino]-5-oxopentanoyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | COc1ccc(CNC(=O)CCCC(=O)Oc2c(C/C=C(\C)CCC(=O)O)c(OC)c(C)c3c2C(=O)OC3)cc1OC |
| InChI | InChI=1S/C31H37NO10/c1-18(10-14-26(34)35)9-12-21-29(40-5)19(2)22-17-41-31(37)28(22)30(21)42-27(36)8-6-7-25(33)32-16-20-11-13-23(38-3)24(15-20)39-4/h9,11,13,15H,6-8,10,12,14,16-17H2,1-5H3,(H,32,33)(H,34,35)/b18-9+ |
| InChIKey | JDWYLHVQSNSLJT-GIJQJNRQSA-N |
| XLogP | 4.44 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|