C30H35NO9 — CID 71504593
(E)-6-[6-methoxy-4-[6-(4-methoxyanilino)-6-oxohexanoyl]oxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 71504593) has the molecular formula C30H35NO9 and a molecular weight of 553.61 g/mol. Its IUPAC name is (E)-6-[6-methoxy-4-[6-(4-methoxyanilino)-6-oxohexanoyl]oxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[6-methoxy-4-[6-(4-methoxyanilino)-6-oxohexanoyl]oxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 71504593 |
| Molecular Formula | C30H35NO9 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | (E)-6-[6-methoxy-4-[6-(4-methoxyanilino)-6-oxohexanoyl]oxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | COc1ccc(NC(=O)CCCCC(=O)Oc2c(C/C=C(\C)CCC(=O)O)c(OC)c(C)c3c2C(=O)OC3)cc1 |
| InChI | InChI=1S/C30H35NO9/c1-18(10-16-25(33)34)9-15-22-28(38-4)19(2)23-17-39-30(36)27(23)29(22)40-26(35)8-6-5-7-24(32)31-20-11-13-21(37-3)14-12-20/h9,11-14H,5-8,10,15-17H2,1-4H3,(H,31,32)(H,33,34)/b18-9+ |
| InChIKey | JKVWDZQIZKMGCT-GIJQJNRQSA-N |
| XLogP | 5.14 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|