C31H39NO9 — CID 123930488
6-[4-[5-(3,4-dimethoxyanilino)-5-oxopentoxy]-6-ethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 123930488) has the molecular formula C31H39NO9 and a molecular weight of 569.65 g/mol. Its IUPAC name is 6-[4-[5-(3,4-dimethoxyanilino)-5-oxopentoxy]-6-ethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | 6-[4-[5-(3,4-dimethoxyanilino)-5-oxopentoxy]-6-ethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 123930488 |
| Molecular Formula | C31H39NO9 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 6-[4-[5-(3,4-dimethoxyanilino)-5-oxopentoxy]-6-ethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | CCOc1c(C)c2c(c(OCCCCC(=O)Nc3ccc(OC)c(OC)c3)c1CC=C(C)CCC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C31H39NO9/c1-6-39-29-20(3)23-18-41-31(36)28(23)30(22(29)13-10-19(2)11-15-27(34)35)40-16-8-7-9-26(33)32-21-12-14-24(37-4)25(17-21)38-5/h10,12,14,17H,6-9,11,13,15-16,18H2,1-5H3,(H,32,33)(H,34,35) |
| InChIKey | VVMIRNNJFRYHGC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|