C26H29NO7 — CID 52905493
methyl 4-[[(E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]benzoate (PubChem CID 52905493) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is methyl 4-[[(E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 52905493 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | methyl 4-[[(E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC/C(C)=C/Cc2c(OC)c(C)c3c(c2OC)C(=O)OC3)cc1 |
| InChI | InChI=1S/C26H29NO7/c1-15(7-13-21(28)27-18-10-8-17(9-11-18)25(29)33-5)6-12-19-23(31-3)16(2)20-14-34-26(30)22(20)24(19)32-4/h6,8-11H,7,12-14H2,1-5H3,(H,27,28)/b15-6+ |
| InChIKey | KHJQEFFEXHPHJE-GIDUJCDVSA-N |
| XLogP | 4.38 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|