C25H35NO6 — CID 71825855
6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N-(2,2-dimethyloxan-4-yl)-4-methylhex-4-enamide (PubChem CID 71825855) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is 6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N-(2,2-dimethyloxan-4-yl)-4-methylhex-4-enamide.
| Compound Name | 6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N-(2,2-dimethyloxan-4-yl)-4-methylhex-4-enamide |
|---|---|
| PubChem CID | 71825855 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-N-(2,2-dimethyloxan-4-yl)-4-methylhex-4-enamide |
| SMILES | COc1c(C)c2c(c(OC)c1CC=C(C)CCC(=O)NC1CCOC(C)(C)C1)C(=O)OC2 |
| InChI | InChI=1S/C25H35NO6/c1-15(8-10-20(27)26-17-11-12-32-25(3,4)13-17)7-9-18-22(29-5)16(2)19-14-31-24(28)21(19)23(18)30-6/h7,17H,8-14H2,1-6H3,(H,26,27) |
| InChIKey | UKHLKGDSYNFLLB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|