C26H37NO5 — CID 52905490
(E)-N-cyclooctyl-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enamide (PubChem CID 52905490) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is (E)-N-cyclooctyl-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enamide.
| Compound Name | (E)-N-cyclooctyl-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enamide |
|---|---|
| PubChem CID | 52905490 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | (E)-N-cyclooctyl-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enamide |
| SMILES | COc1c(C)c2c(c(OC)c1C/C=C(\C)CCC(=O)NC1CCCCCCC1)C(=O)OC2 |
| InChI | InChI=1S/C26H37NO5/c1-17(13-15-22(28)27-19-10-8-6-5-7-9-11-19)12-14-20-24(30-3)18(2)21-16-32-26(29)23(21)25(20)31-4/h12,19H,5-11,13-16H2,1-4H3,(H,27,28)/b17-12+ |
| InChIKey | OISGBSMBSYUILH-SFQUDFHCSA-N |
| XLogP | 5.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|