C27H35NO8 — CID 78089967
6-[6-methoxy-7-methyl-3-oxo-4-(5-oxo-5-piperidin-1-ylpentanoyl)oxy-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 78089967) has the molecular formula C27H35NO8 and a molecular weight of 501.58 g/mol. Its IUPAC name is 6-[6-methoxy-7-methyl-3-oxo-4-(5-oxo-5-piperidin-1-ylpentanoyl)oxy-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | 6-[6-methoxy-7-methyl-3-oxo-4-(5-oxo-5-piperidin-1-ylpentanoyl)oxy-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 78089967 |
| Molecular Formula | C27H35NO8 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 6-[6-methoxy-7-methyl-3-oxo-4-(5-oxo-5-piperidin-1-ylpentanoyl)oxy-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | COc1c(C)c2c(c(OC(=O)CCCC(=O)N3CCCCC3)c1CC=C(C)CCC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C27H35NO8/c1-17(11-13-22(30)31)10-12-19-25(34-3)18(2)20-16-35-27(33)24(20)26(19)36-23(32)9-7-8-21(29)28-14-5-4-6-15-28/h10H,4-9,11-16H2,1-3H3,(H,30,31) |
| InChIKey | PPIZUXBBUGZGPW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|