C18H37FN2 — CID 167064935
(3S,4S)-4-fluoro-1-tetradecan-7-ylpyrrolidin-3-amine (PubChem CID 167064935) has the molecular formula C18H37FN2 and a molecular weight of 300.51 g/mol. Its IUPAC name is (3S,4S)-4-fluoro-1-tetradecan-7-ylpyrrolidin-3-amine.
| Compound Name | (3S,4S)-4-fluoro-1-tetradecan-7-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 167064935 |
| Molecular Formula | C18H37FN2 |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | (3S,4S)-4-fluoro-1-tetradecan-7-ylpyrrolidin-3-amine |
| SMILES | CCCCCCCC(CCCCCC)N1C[C@H](N)[C@@H](F)C1 |
| InChI | InChI=1S/C18H37FN2/c1-3-5-7-9-11-13-16(12-10-8-6-4-2)21-14-17(19)18(20)15-21/h16-18H,3-15,20H2,1-2H3/t16?,17-,18-/m0/s1 |
| InChIKey | UATWSZFJQHEBAE-FQECFTEESA-N |
| XLogP | 4.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|