C20H45N3 — CID 146311953
(2S,3S)-2-N,2-N-dimethyloctadecane-1,2,3-triamine (PubChem CID 146311953) has the molecular formula C20H45N3 and a molecular weight of 327.60 g/mol. Its IUPAC name is (2S,3S)-2-N,2-N-dimethyloctadecane-1,2,3-triamine.
| Compound Name | (2S,3S)-2-N,2-N-dimethyloctadecane-1,2,3-triamine |
|---|---|
| PubChem CID | 146311953 |
| Molecular Formula | C20H45N3 |
| Molecular Weight | 327.60 g/mol |
| Exact Mass | 327.36 |
| IUPAC Name | (2S,3S)-2-N,2-N-dimethyloctadecane-1,2,3-triamine |
| SMILES | CCCCCCCCCCCCCCC[C@H](N)[C@H](CN)N(C)C |
| InChI | InChI=1S/C20H45N3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20(18-21)23(2)3/h19-20H,4-18,21-22H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | UISOALSXQDJSJJ-PMACEKPBSA-N |
| XLogP | 4.68 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|