C52H54N2 — CID 167065646
1-N,1-N,6-N,6-N-tetrakis(4-propan-2-ylphenyl)-4,5-dihydropyrene-1,6-diamine (PubChem CID 167065646) has the molecular formula C52H54N2 and a molecular weight of 707.02 g/mol. Its IUPAC name is 1-N,1-N,6-N,6-N-tetrakis(4-propan-2-ylphenyl)-4,5-dihydropyrene-1,6-diamine.
| Compound Name | 1-N,1-N,6-N,6-N-tetrakis(4-propan-2-ylphenyl)-4,5-dihydropyrene-1,6-diamine |
|---|---|
| PubChem CID | 167065646 |
| Molecular Formula | C52H54N2 |
| Molecular Weight | 707.02 g/mol |
| Exact Mass | 706.43 |
| IUPAC Name | 1-N,1-N,6-N,6-N-tetrakis(4-propan-2-ylphenyl)-4,5-dihydropyrene-1,6-diamine |
| SMILES | CC(C)c1ccc(N(c2ccc(C(C)C)cc2)c2ccc3ccc4c(N(c5ccc(C(C)C)cc5)c5ccc(C(C)C)cc5)ccc5c4c3c2CC5)cc1 |
| InChI | InChI=1S/C52H54N2/c1-33(2)37-9-21-43(22-10-37)53(44-23-11-38(12-24-44)34(3)4)49-31-19-41-18-30-48-50(32-20-42-17-29-47(49)51(41)52(42)48)54(45-25-13-39(14-26-45)35(5)6)46-27-15-40(16-28-46)36(7)8/h9-17,19-29,31-36H,18,30H2,1-8H3 |
| InChIKey | HUSKTDHLPGGLNG-UHFFFAOYSA-N |
| XLogP | 15.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.02 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|