C50H50N4 — CID 170443596
1-N,6-N-bis(4-propan-2-ylphenyl)-1-N,6-N-bis(5-propan-2-yl-2-pyridinyl)pyrene-1,6-diamine (PubChem CID 170443596) has the molecular formula C50H50N4 and a molecular weight of 706.98 g/mol. Its IUPAC name is 1-N,6-N-bis(4-propan-2-ylphenyl)-1-N,6-N-bis(5-propan-2-yl-2-pyridinyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis(4-propan-2-ylphenyl)-1-N,6-N-bis(5-propan-2-yl-2-pyridinyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 170443596 |
| Molecular Formula | C50H50N4 |
| Molecular Weight | 706.98 g/mol |
| Exact Mass | 706.40 |
| IUPAC Name | 1-N,6-N-bis(4-propan-2-ylphenyl)-1-N,6-N-bis(5-propan-2-yl-2-pyridinyl)pyrene-1,6-diamine |
| SMILES | CC(C)c1ccc(N(c2ccc(C(C)C)cn2)c2ccc3ccc4c(N(c5ccc(C(C)C)cc5)c5ccc(C(C)C)cn5)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C50H50N4/c1-31(2)35-9-19-41(20-10-35)53(47-27-17-39(29-51-47)33(5)6)45-25-15-37-14-24-44-46(26-16-38-13-23-43(45)49(37)50(38)44)54(42-21-11-36(12-22-42)32(3)4)48-28-18-40(30-52-48)34(7)8/h9-34H,1-8H3 |
| InChIKey | WEKAUKBKOOBIIY-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.98 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|