C29H54N2O — CID 167068678
4-hexan-2-yl-7-tridecan-6-yloxy-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine (PubChem CID 167068678) has the molecular formula C29H54N2O and a molecular weight of 446.76 g/mol. Its IUPAC name is 4-hexan-2-yl-7-tridecan-6-yloxy-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine.
| Compound Name | 4-hexan-2-yl-7-tridecan-6-yloxy-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 167068678 |
| Molecular Formula | C29H54N2O |
| Molecular Weight | 446.76 g/mol |
| Exact Mass | 446.42 |
| IUPAC Name | 4-hexan-2-yl-7-tridecan-6-yloxy-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine |
| SMILES | CCCCCCCC(CCCCC)OC1CCCC2C=NNC(C(C)CCCC)=C2CC1 |
| InChI | InChI=1S/C29H54N2O/c1-5-8-11-12-14-19-26(18-13-9-6-2)32-27-20-15-17-25-23-30-31-29(28(25)22-21-27)24(4)16-10-7-3/h23-27,31H,5-22H2,1-4H3 |
| InChIKey | GMQWBQSFAJFGTO-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.76 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|